Chemistry is the science of change. But why do chemical reactions take place? Why do chemicals react with each other? The answer is in thermodynamics and kinetics, 120-61-6, Name is Dimethyl terephthalate, SMILES is O=C(OC)C1=CC=C(C(OC)=O)C=C1, belongs to esters-buliding-blocks compound. In a document, author is Tran, Khoa M., introduce the new discover, COA of Formula: C10H10O4.
Synthesis of primary N-arylthioglyoxamides from anilines, elemental sulfur and primary C-H bonds in acetophenones
A simple method for coupling of anilines, acetophenones, and elemental sulfur to afford N-arylthioglyoxamides has been developed. Reactions proceeded in the presence of Na2SO3 and DMSO, thus eliminating the need for transition metals and external oxidants. Functionalities such as halogen, ester, methylthio, and heterocycle groups were compatible with the conditions. Electron-poor acetophenones sometimes gave isosteric glyoxamides.
The proportionality constant is the rate constant for the particular unimolecular reaction. the reaction rate is directly proportional to the concentration of the reactant. I hope my blog about 120-61-6 is helpful to your research. COA of Formula: C10H10O4.